C13H23N3O2 — CID 127045621
3-methylpentan-2-yl N-(3-imidazol-1-ylpropyl)carbamate (PubChem CID 127045621) has the molecular formula C13H23N3O2 and a molecular weight of 253.35 g/mol. Its IUPAC name is 3-methylpentan-2-yl N-(3-imidazol-1-ylpropyl)carbamate.
| Compound Name | 3-methylpentan-2-yl N-(3-imidazol-1-ylpropyl)carbamate |
|---|---|
| PubChem CID | 127045621 |
| Molecular Formula | C13H23N3O2 |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | 3-methylpentan-2-yl N-(3-imidazol-1-ylpropyl)carbamate |
| SMILES | CCC(C)C(C)OC(=O)NCCCn1ccnc1 |
| InChI | InChI=1S/C13H23N3O2/c1-4-11(2)12(3)18-13(17)15-6-5-8-16-9-7-14-10-16/h7,9-12H,4-6,8H2,1-3H3,(H,15,17) |
| InChIKey | LNIYBDMNFKOCBA-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|