About 3-[(1-decyltriazol-4-yl)methyl]-2-ethyl-7-(trifluoromethyl)pyrido[2,3-d]pyrimidin-4-one
3-[(1-decyltriazol-4-yl)methyl]-2-ethyl-7-(trifluoromethyl)pyrido[2,3-d]pyrimidin-4-one (PubChem CID 127045722) has the molecular formula C23H31F3N6O
and a molecular weight of 464.54 g/mol. Its IUPAC name is 3-[(1-decyltriazol-4-yl)methyl]-2-ethyl-7-(trifluoromethyl)pyrido[2,3-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 3-[(1-decyltriazol-4-yl)methyl]-2-ethyl-7-(trifluoromethyl)pyrido[2,3-d]pyrimidin-4-one |
| PubChem CID | 127045722 |
| Molecular Formula | C23H31F3N6O |
| Molecular Weight | 464.54 g/mol |
| Exact Mass | 464.25 |
| IUPAC Name | 3-[(1-decyltriazol-4-yl)methyl]-2-ethyl-7-(trifluoromethyl)pyrido[2,3-d]pyrimidin-4-one |
| SMILES | CCCCCCCCCCn1cc(Cn2c(CC)nc3nc(C(F)(F)F)ccc3c2=O)nn1 |
| InChI | InChI=1S/C23H31F3N6O/c1-3-5-6-7-8-9-10-11-14-31-15-17(29-30-31)16-32-20(4-2)28-21-18(22(32)33)12-13-19(27-21)23(24,25)26/h12-13,15H,3-11,14,16H2,1-2H3 |
| InChIKey | YXJAFRZWBMMRJX-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 78.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 464.54 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[(1-decyltriazol-4-yl)methyl]-2-ethyl-7-(trifluoromethyl)pyrido[2,3-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1-decyltriazol-4-yl)methyl]-2-ethyl-7-(trifluoromethyl)pyrido[2,3-d]pyrimidin-4-one?
The IUPAC name of 3-[(1-decyltriazol-4-yl)methyl]-2-ethyl-7-(trifluoromethyl)pyrido[2,3-d]pyrimidin-4-one (CID 127045722) is 3-[(1-decyltriazol-4-yl)methyl]-2-ethyl-7-(trifluoromethyl)pyrido[2,3-d]pyrimidin-4-one.
What is the SMILES notation for 3-[(1-decyltriazol-4-yl)methyl]-2-ethyl-7-(trifluoromethyl)pyrido[2,3-d]pyrimidin-4-one?
The canonical SMILES for 3-[(1-decyltriazol-4-yl)methyl]-2-ethyl-7-(trifluoromethyl)pyrido[2,3-d]pyrimidin-4-one is CCCCCCCCCCn1cc(Cn2c(CC)nc3nc(C(F)(F)F)ccc3c2=O)nn1.
What is the InChIKey of 3-[(1-decyltriazol-4-yl)methyl]-2-ethyl-7-(trifluoromethyl)pyrido[2,3-d]pyrimidin-4-one?
The InChIKey is YXJAFRZWBMMRJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H31F3N6O/c1-3-5-6-7-8-9-10-11-14-31-15-17(29-30-31)16-32-20(4-2)28-21-18(22(32)33)12-13-19(27-21)23(24,25)26/h12-13,15H,3-11,14,16H2,1-2H3.
What are the key properties of 3-[(1-decyltriazol-4-yl)methyl]-2-ethyl-7-(trifluoromethyl)pyrido[2,3-d]pyrimidin-4-one?
3-[(1-decyltriazol-4-yl)methyl]-2-ethyl-7-(trifluoromethyl)pyrido[2,3-d]pyrimidin-4-one has a molecular weight of 464.54 g/mol, XLogP of 5.15, 12 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1-decyltriazol-4-yl)methyl]-2-ethyl-7-(trifluoromethyl)pyrido[2,3-d]pyrimidin-4-one is sourced from PubChem (CID 127045722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).