About 1-(4,5-dihydro-1H-imidazol-2-ylmethyl)indole;hydrochloride
1-(4,5-dihydro-1H-imidazol-2-ylmethyl)indole;hydrochloride (PubChem CID 127045823) has the molecular formula C12H14ClN3
and a molecular weight of 235.72 g/mol. Its IUPAC name is 1-(4,5-dihydro-1H-imidazol-2-ylmethyl)indole;hydrochloride.
Molecular Properties
| Compound Name | 1-(4,5-dihydro-1H-imidazol-2-ylmethyl)indole;hydrochloride |
| PubChem CID | 127045823 |
| Molecular Formula | C12H14ClN3 |
| Molecular Weight | 235.72 g/mol |
| Exact Mass | 235.09 |
| IUPAC Name | 1-(4,5-dihydro-1H-imidazol-2-ylmethyl)indole;hydrochloride |
| SMILES | Cl.c1ccc2c(c1)ccn2CC1=NCCN1 |
| InChI | InChI=1S/C12H13N3.ClH/c1-2-4-11-10(3-1)5-8-15(11)9-12-13-6-7-14-12;/h1-5,8H,6-7,9H2,(H,13,14);1H |
| InChIKey | VNNVPLCROZGJMJ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 29.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.72 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(4,5-dihydro-1H-imidazol-2-ylmethyl)indole;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4,5-dihydro-1H-imidazol-2-ylmethyl)indole;hydrochloride?
The IUPAC name of 1-(4,5-dihydro-1H-imidazol-2-ylmethyl)indole;hydrochloride (CID 127045823) is 1-(4,5-dihydro-1H-imidazol-2-ylmethyl)indole;hydrochloride.
What is the SMILES notation for 1-(4,5-dihydro-1H-imidazol-2-ylmethyl)indole;hydrochloride?
The canonical SMILES for 1-(4,5-dihydro-1H-imidazol-2-ylmethyl)indole;hydrochloride is Cl.c1ccc2c(c1)ccn2CC1=NCCN1.
What is the InChIKey of 1-(4,5-dihydro-1H-imidazol-2-ylmethyl)indole;hydrochloride?
The InChIKey is VNNVPLCROZGJMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13N3.ClH/c1-2-4-11-10(3-1)5-8-15(11)9-12-13-6-7-14-12;/h1-5,8H,6-7,9H2,(H,13,14);1H.
What are the key properties of 1-(4,5-dihydro-1H-imidazol-2-ylmethyl)indole;hydrochloride?
1-(4,5-dihydro-1H-imidazol-2-ylmethyl)indole;hydrochloride has a molecular weight of 235.72 g/mol, XLogP of 2.06, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4,5-dihydro-1H-imidazol-2-ylmethyl)indole;hydrochloride is sourced from PubChem (CID 127045823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).