C27H31N7O2 — CID 127045880
4-(dimethylamino)-N-[3-(1,3-oxazol-5-yl)phenyl]-1-(6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indol-4-yl)piperidine-4-carboxamide (PubChem CID 127045880) has the molecular formula C27H31N7O2 and a molecular weight of 485.59 g/mol. Its IUPAC name is 4-(dimethylamino)-N-[3-(1,3-oxazol-5-yl)phenyl]-1-(6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indol-4-yl)piperidine-4-carboxamide.
| Compound Name | 4-(dimethylamino)-N-[3-(1,3-oxazol-5-yl)phenyl]-1-(6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indol-4-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 127045880 |
| Molecular Formula | C27H31N7O2 |
| Molecular Weight | 485.59 g/mol |
| Exact Mass | 485.25 |
| IUPAC Name | 4-(dimethylamino)-N-[3-(1,3-oxazol-5-yl)phenyl]-1-(6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indol-4-yl)piperidine-4-carboxamide |
| SMILES | CN(C)C1(C(=O)Nc2cccc(-c3cnco3)c2)CCN(c2ncnc3[nH]c4c(c23)CCCC4)CC1 |
| InChI | InChI=1S/C27H31N7O2/c1-33(2)27(26(35)31-19-7-5-6-18(14-19)22-15-28-17-36-22)10-12-34(13-11-27)25-23-20-8-3-4-9-21(20)32-24(23)29-16-30-25/h5-7,14-17H,3-4,8-13H2,1-2H3,(H,31,35)(H,29,30,32) |
| InChIKey | UJCLBWBWMXJXCM-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 103.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.59 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |