C34H31N3O8 — CID 127045892
4-[2-[4-[[4-[(1E,4E)-5-(3,4-dimethoxyphenyl)-3-oxopenta-1,4-dienyl]-2-methoxyphenoxy]methyl]triazol-1-yl]ethoxy]chromen-2-one (PubChem CID 127045892) has the molecular formula C34H31N3O8 and a molecular weight of 609.64 g/mol. Its IUPAC name is 4-[2-[4-[[4-[(1E,4E)-5-(3,4-dimethoxyphenyl)-3-oxopenta-1,4-dienyl]-2-methoxyphenoxy]methyl]triazol-1-yl]ethoxy]chromen-2-one.
| Compound Name | 4-[2-[4-[[4-[(1E,4E)-5-(3,4-dimethoxyphenyl)-3-oxopenta-1,4-dienyl]-2-methoxyphenoxy]methyl]triazol-1-yl]ethoxy]chromen-2-one |
|---|---|
| PubChem CID | 127045892 |
| Molecular Formula | C34H31N3O8 |
| Molecular Weight | 609.64 g/mol |
| Exact Mass | 609.21 |
| IUPAC Name | 4-[2-[4-[[4-[(1E,4E)-5-(3,4-dimethoxyphenyl)-3-oxopenta-1,4-dienyl]-2-methoxyphenoxy]methyl]triazol-1-yl]ethoxy]chromen-2-one |
| SMILES | COc1ccc(/C=C/C(=O)/C=C/c2ccc(OCc3cn(CCOc4cc(=O)oc5ccccc45)nn3)c(OC)c2)cc1OC |
| InChI | InChI=1S/C34H31N3O8/c1-40-29-14-10-23(18-32(29)41-2)8-12-26(38)13-9-24-11-15-30(33(19-24)42-3)44-22-25-21-37(36-35-25)16-17-43-31-20-34(39)45-28-7-5-4-6-27(28)31/h4-15,18-21H,16-17,22H2,1-3H3/b12-8+,13-9+ |
| InChIKey | KMODHBAKROAZAJ-QHKWOANTSA-N |
| XLogP | 5.36 |
| TPSA | 124.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.64 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|