C29H32N2O5 — CID 127045898
N-(1-adamantyl)-5-[4-(3,4,5-trimethoxyphenyl)phenyl]-1,2-oxazole-3-carboxamide (PubChem CID 127045898) has the molecular formula C29H32N2O5 and a molecular weight of 488.58 g/mol. Its IUPAC name is N-(1-adamantyl)-5-[4-(3,4,5-trimethoxyphenyl)phenyl]-1,2-oxazole-3-carboxamide.
| Compound Name | N-(1-adamantyl)-5-[4-(3,4,5-trimethoxyphenyl)phenyl]-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 127045898 |
| Molecular Formula | C29H32N2O5 |
| Molecular Weight | 488.58 g/mol |
| Exact Mass | 488.23 |
| IUPAC Name | N-(1-adamantyl)-5-[4-(3,4,5-trimethoxyphenyl)phenyl]-1,2-oxazole-3-carboxamide |
| SMILES | COc1cc(-c2ccc(-c3cc(C(=O)NC45CC6CC(CC(C6)C4)C5)no3)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C29H32N2O5/c1-33-25-11-22(12-26(34-2)27(25)35-3)20-4-6-21(7-5-20)24-13-23(31-36-24)28(32)30-29-14-17-8-18(15-29)10-19(9-17)16-29/h4-7,11-13,17-19H,8-10,14-16H2,1-3H3,(H,30,32) |
| InChIKey | WAJKTWYEFNTPQP-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 82.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.58 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |