C21H17ClN4O2 — CID 127045933
N-[(1S)-1-(3-chlorophenyl)-2-hydroxyethyl]-3-pyridin-4-yl-1H-indazole-5-carboxamide (PubChem CID 127045933) has the molecular formula C21H17ClN4O2 and a molecular weight of 392.85 g/mol. Its IUPAC name is N-[(1S)-1-(3-chlorophenyl)-2-hydroxyethyl]-3-pyridin-4-yl-1H-indazole-5-carboxamide.
| Compound Name | N-[(1S)-1-(3-chlorophenyl)-2-hydroxyethyl]-3-pyridin-4-yl-1H-indazole-5-carboxamide |
|---|---|
| PubChem CID | 127045933 |
| Molecular Formula | C21H17ClN4O2 |
| Molecular Weight | 392.85 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | N-[(1S)-1-(3-chlorophenyl)-2-hydroxyethyl]-3-pyridin-4-yl-1H-indazole-5-carboxamide |
| SMILES | O=C(N[C@H](CO)c1cccc(Cl)c1)c1ccc2[nH]nc(-c3ccncc3)c2c1 |
| InChI | InChI=1S/C21H17ClN4O2/c22-16-3-1-2-14(10-16)19(12-27)24-21(28)15-4-5-18-17(11-15)20(26-25-18)13-6-8-23-9-7-13/h1-11,19,27H,12H2,(H,24,28)(H,25,26)/t19-/m1/s1 |
| InChIKey | PRQMKPLDKYLQOM-LJQANCHMSA-N |
| XLogP | 3.74 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.85 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |