C25H14F16N6O — CID 127045936
2-phenyl-3-[[1-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)triazol-4-yl]methyl]-7-(trifluoromethyl)pyrido[2,3-d]pyrimidin-4-one (PubChem CID 127045936) has the molecular formula C25H14F16N6O and a molecular weight of 718.40 g/mol. Its IUPAC name is 2-phenyl-3-[[1-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)triazol-4-yl]methyl]-7-(trifluoromethyl)pyrido[2,3-d]pyrimidin-4-one.
| Compound Name | 2-phenyl-3-[[1-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)triazol-4-yl]methyl]-7-(trifluoromethyl)pyrido[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 127045936 |
| Molecular Formula | C25H14F16N6O |
| Molecular Weight | 718.40 g/mol |
| Exact Mass | 718.10 |
| IUPAC Name | 2-phenyl-3-[[1-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)triazol-4-yl]methyl]-7-(trifluoromethyl)pyrido[2,3-d]pyrimidin-4-one |
| SMILES | O=c1c2ccc(C(F)(F)F)nc2nc(-c2ccccc2)n1Cc1cn(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)nn1 |
| InChI | InChI=1S/C25H14F16N6O/c26-19(27,21(31,32)22(33,34)23(35,36)24(37,38)25(39,40)41)8-9-46-10-13(44-45-46)11-47-17(12-4-2-1-3-5-12)43-16-14(18(47)48)6-7-15(42-16)20(28,29)30/h1-7,10H,8-9,11H2 |
| InChIKey | DSMHNUVVDNKUFA-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 78.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.40 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|