C21H14F16N6O — CID 127045937
2-ethyl-3-[[1-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)triazol-4-yl]methyl]-7-(trifluoromethyl)pyrido[2,3-d]pyrimidin-4-one (PubChem CID 127045937) has the molecular formula C21H14F16N6O and a molecular weight of 670.35 g/mol. Its IUPAC name is 2-ethyl-3-[[1-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)triazol-4-yl]methyl]-7-(trifluoromethyl)pyrido[2,3-d]pyrimidin-4-one.
| Compound Name | 2-ethyl-3-[[1-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)triazol-4-yl]methyl]-7-(trifluoromethyl)pyrido[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 127045937 |
| Molecular Formula | C21H14F16N6O |
| Molecular Weight | 670.35 g/mol |
| Exact Mass | 670.10 |
| IUPAC Name | 2-ethyl-3-[[1-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)triazol-4-yl]methyl]-7-(trifluoromethyl)pyrido[2,3-d]pyrimidin-4-one |
| SMILES | CCc1nc2nc(C(F)(F)F)ccc2c(=O)n1Cc1cn(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)nn1 |
| InChI | InChI=1S/C21H14F16N6O/c1-2-12-39-13-10(3-4-11(38-13)16(24,25)26)14(44)43(12)8-9-7-42(41-40-9)6-5-15(22,23)17(27,28)18(29,30)19(31,32)20(33,34)21(35,36)37/h3-4,7H,2,5-6,8H2,1H3 |
| InChIKey | AWSCRJJKZKBVQD-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 78.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.35 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|