C34H40Br2N4O2 — CID 127046153
7-methoxy-2-[8-(7-methoxy-1-methyl-9H-pyrido[3,4-b]indol-2-ium-2-yl)octyl]-1-methyl-9H-pyrido[3,4-b]indol-2-ium dibromide (PubChem CID 127046153) has the molecular formula C34H40Br2N4O2 and a molecular weight of 696.53 g/mol. Its IUPAC name is 7-methoxy-2-[8-(7-methoxy-1-methyl-9H-pyrido[3,4-b]indol-2-ium-2-yl)octyl]-1-methyl-9H-pyrido[3,4-b]indol-2-ium dibromide.
| Compound Name | 7-methoxy-2-[8-(7-methoxy-1-methyl-9H-pyrido[3,4-b]indol-2-ium-2-yl)octyl]-1-methyl-9H-pyrido[3,4-b]indol-2-ium dibromide |
|---|---|
| PubChem CID | 127046153 |
| Molecular Formula | C34H40Br2N4O2 |
| Molecular Weight | 696.53 g/mol |
| Exact Mass | 694.15 |
| IUPAC Name | 7-methoxy-2-[8-(7-methoxy-1-methyl-9H-pyrido[3,4-b]indol-2-ium-2-yl)octyl]-1-methyl-9H-pyrido[3,4-b]indol-2-ium dibromide |
| SMILES | COc1ccc2c(c1)[nH]c1c(C)[n+](CCCCCCCC[n+]3ccc4c([nH]c5cc(OC)ccc54)c3C)ccc12.[Br-].[Br-] |
| InChI | InChI=1S/C34H38N4O2.2BrH/c1-23-33-29(27-13-11-25(39-3)21-31(27)35-33)15-19-37(23)17-9-7-5-6-8-10-18-38-20-16-30-28-14-12-26(40-4)22-32(28)36-34(30)24(38)2;;/h11-16,19-22H,5-10,17-18H2,1-4H3;2*1H |
| InChIKey | FTKBVYIETLTYEJ-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 57.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.53 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|