C21H24O7 — CID 127046195
[(5S,6R,7R,10R)-6-acetyloxy-10-[(1E,3E)-hepta-1,3-dienyl]-3-methylidene-1,4-dioxo-2-oxaspiro[4.5]dec-8-en-7-yl] acetate (PubChem CID 127046195) has the molecular formula C21H24O7 and a molecular weight of 388.42 g/mol. Its IUPAC name is [(5S,6R,7R,10R)-6-acetyloxy-10-[(1E,3E)-hepta-1,3-dienyl]-3-methylidene-1,4-dioxo-2-oxaspiro[4.5]dec-8-en-7-yl] acetate.
| Compound Name | [(5S,6R,7R,10R)-6-acetyloxy-10-[(1E,3E)-hepta-1,3-dienyl]-3-methylidene-1,4-dioxo-2-oxaspiro[4.5]dec-8-en-7-yl] acetate |
|---|---|
| PubChem CID | 127046195 |
| Molecular Formula | C21H24O7 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | [(5S,6R,7R,10R)-6-acetyloxy-10-[(1E,3E)-hepta-1,3-dienyl]-3-methylidene-1,4-dioxo-2-oxaspiro[4.5]dec-8-en-7-yl] acetate |
| SMILES | C=C1OC(=O)[C@@]2(C1=O)[C@H](/C=C/C=C/CCC)C=C[C@@H](OC(C)=O)[C@@H]2OC(C)=O |
| InChI | InChI=1S/C21H24O7/c1-5-6-7-8-9-10-16-11-12-17(27-14(3)22)19(28-15(4)23)21(16)18(24)13(2)26-20(21)25/h7-12,16-17,19H,2,5-6H2,1,3-4H3/b8-7+,10-9+/t16-,17-,19+,21-/m1/s1 |
| InChIKey | ZJKYOCRWJPLOAC-ODWZNREKSA-N |
| XLogP | 2.57 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|