C26H30N6O3S — CID 127046321
N-[3-[2-[2-methoxy-4-(4-methylpiperazin-1-yl)anilino]-5-methylsulfanylpyrimidin-4-yl]oxyphenyl]prop-2-enamide (PubChem CID 127046321) has the molecular formula C26H30N6O3S and a molecular weight of 506.63 g/mol. Its IUPAC name is N-[3-[2-[2-methoxy-4-(4-methylpiperazin-1-yl)anilino]-5-methylsulfanylpyrimidin-4-yl]oxyphenyl]prop-2-enamide.
| Compound Name | N-[3-[2-[2-methoxy-4-(4-methylpiperazin-1-yl)anilino]-5-methylsulfanylpyrimidin-4-yl]oxyphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 127046321 |
| Molecular Formula | C26H30N6O3S |
| Molecular Weight | 506.63 g/mol |
| Exact Mass | 506.21 |
| IUPAC Name | N-[3-[2-[2-methoxy-4-(4-methylpiperazin-1-yl)anilino]-5-methylsulfanylpyrimidin-4-yl]oxyphenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(Oc2nc(Nc3ccc(N4CCN(C)CC4)cc3OC)ncc2SC)c1 |
| InChI | InChI=1S/C26H30N6O3S/c1-5-24(33)28-18-7-6-8-20(15-18)35-25-23(36-4)17-27-26(30-25)29-21-10-9-19(16-22(21)34-3)32-13-11-31(2)12-14-32/h5-10,15-17H,1,11-14H2,2-4H3,(H,28,33)(H,27,29,30) |
| InChIKey | JGVSJOHBWPEWKW-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 91.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.63 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|