C30H32Br2N4O2 — CID 127046332
7-methoxy-2-[4-(7-methoxy-1-methyl-9H-pyrido[3,4-b]indol-2-ium-2-yl)butyl]-1-methyl-9H-pyrido[3,4-b]indol-2-ium dibromide (PubChem CID 127046332) has the molecular formula C30H32Br2N4O2 and a molecular weight of 640.42 g/mol. Its IUPAC name is 7-methoxy-2-[4-(7-methoxy-1-methyl-9H-pyrido[3,4-b]indol-2-ium-2-yl)butyl]-1-methyl-9H-pyrido[3,4-b]indol-2-ium dibromide.
| Compound Name | 7-methoxy-2-[4-(7-methoxy-1-methyl-9H-pyrido[3,4-b]indol-2-ium-2-yl)butyl]-1-methyl-9H-pyrido[3,4-b]indol-2-ium dibromide |
|---|---|
| PubChem CID | 127046332 |
| Molecular Formula | C30H32Br2N4O2 |
| Molecular Weight | 640.42 g/mol |
| Exact Mass | 638.09 |
| IUPAC Name | 7-methoxy-2-[4-(7-methoxy-1-methyl-9H-pyrido[3,4-b]indol-2-ium-2-yl)butyl]-1-methyl-9H-pyrido[3,4-b]indol-2-ium dibromide |
| SMILES | COc1ccc2c(c1)[nH]c1c(C)[n+](CCCC[n+]3ccc4c([nH]c5cc(OC)ccc54)c3C)ccc12.[Br-].[Br-] |
| InChI | InChI=1S/C30H30N4O2.2BrH/c1-19-29-25(23-9-7-21(35-3)17-27(23)31-29)11-15-33(19)13-5-6-14-34-16-12-26-24-10-8-22(36-4)18-28(24)32-30(26)20(34)2;;/h7-12,15-18H,5-6,13-14H2,1-4H3;2*1H |
| InChIKey | SMTNQCZNHSONOH-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 57.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.42 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|