C20H30O4 — CID 127046357
(2S,6R,7R,11R,12R,14S)-11-hydroxy-2,6-dimethyl-12-propan-2-yl-13-oxatetracyclo[8.5.0.02,7.012,14]pentadec-1(10)-ene-6-carboxylic acid (PubChem CID 127046357) has the molecular formula C20H30O4 and a molecular weight of 334.46 g/mol. Its IUPAC name is (2S,6R,7R,11R,12R,14S)-11-hydroxy-2,6-dimethyl-12-propan-2-yl-13-oxatetracyclo[8.5.0.02,7.012,14]pentadec-1(10)-ene-6-carboxylic acid.
| Compound Name | (2S,6R,7R,11R,12R,14S)-11-hydroxy-2,6-dimethyl-12-propan-2-yl-13-oxatetracyclo[8.5.0.02,7.012,14]pentadec-1(10)-ene-6-carboxylic acid |
|---|---|
| PubChem CID | 127046357 |
| Molecular Formula | C20H30O4 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | (2S,6R,7R,11R,12R,14S)-11-hydroxy-2,6-dimethyl-12-propan-2-yl-13-oxatetracyclo[8.5.0.02,7.012,14]pentadec-1(10)-ene-6-carboxylic acid |
| SMILES | CC(C)[C@]12O[C@H]1CC1=C(CC[C@H]3[C@](C)(C(=O)O)CCC[C@]13C)[C@H]2O |
| InChI | InChI=1S/C20H30O4/c1-11(2)20-15(24-20)10-13-12(16(20)21)6-7-14-18(13,3)8-5-9-19(14,4)17(22)23/h11,14-16,21H,5-10H2,1-4H3,(H,22,23)/t14-,15+,16-,18-,19-,20+/m1/s1 |
| InChIKey | PGHRSWJTZYEQGT-UXESJPJBSA-N |
| XLogP | 3.53 |
| TPSA | 70.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|