C20H32O5 — CID 127046358
(1R,2S,6R,7R,10S,11R,12R,14S)-10,11-dihydroxy-2,6-dimethyl-12-propan-2-yl-13-oxatetracyclo[8.5.0.02,7.012,14]pentadecane-6-carboxylic acid (PubChem CID 127046358) has the molecular formula C20H32O5 and a molecular weight of 352.47 g/mol. Its IUPAC name is (1R,2S,6R,7R,10S,11R,12R,14S)-10,11-dihydroxy-2,6-dimethyl-12-propan-2-yl-13-oxatetracyclo[8.5.0.02,7.012,14]pentadecane-6-carboxylic acid.
| Compound Name | (1R,2S,6R,7R,10S,11R,12R,14S)-10,11-dihydroxy-2,6-dimethyl-12-propan-2-yl-13-oxatetracyclo[8.5.0.02,7.012,14]pentadecane-6-carboxylic acid |
|---|---|
| PubChem CID | 127046358 |
| Molecular Formula | C20H32O5 |
| Molecular Weight | 352.47 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | (1R,2S,6R,7R,10S,11R,12R,14S)-10,11-dihydroxy-2,6-dimethyl-12-propan-2-yl-13-oxatetracyclo[8.5.0.02,7.012,14]pentadecane-6-carboxylic acid |
| SMILES | CC(C)[C@]12O[C@H]1C[C@@H]1[C@@]3(C)CCC[C@@](C)(C(=O)O)[C@@H]3CC[C@@]1(O)[C@H]2O |
| InChI | InChI=1S/C20H32O5/c1-11(2)20-14(25-20)10-13-17(3)7-5-8-18(4,16(22)23)12(17)6-9-19(13,24)15(20)21/h11-15,21,24H,5-10H2,1-4H3,(H,22,23)/t12-,13-,14+,15-,17+,18-,19+,20+/m1/s1 |
| InChIKey | VUKHORQAZYZECW-AEOKPUCASA-N |
| XLogP | 2.58 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.47 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|