C31H34Br2N4O2 — CID 127046504
7-methoxy-2-[5-(7-methoxy-1-methyl-9H-pyrido[3,4-b]indol-2-ium-2-yl)pentyl]-1-methyl-9H-pyrido[3,4-b]indol-2-ium dibromide (PubChem CID 127046504) has the molecular formula C31H34Br2N4O2 and a molecular weight of 654.45 g/mol. Its IUPAC name is 7-methoxy-2-[5-(7-methoxy-1-methyl-9H-pyrido[3,4-b]indol-2-ium-2-yl)pentyl]-1-methyl-9H-pyrido[3,4-b]indol-2-ium dibromide.
| Compound Name | 7-methoxy-2-[5-(7-methoxy-1-methyl-9H-pyrido[3,4-b]indol-2-ium-2-yl)pentyl]-1-methyl-9H-pyrido[3,4-b]indol-2-ium dibromide |
|---|---|
| PubChem CID | 127046504 |
| Molecular Formula | C31H34Br2N4O2 |
| Molecular Weight | 654.45 g/mol |
| Exact Mass | 652.10 |
| IUPAC Name | 7-methoxy-2-[5-(7-methoxy-1-methyl-9H-pyrido[3,4-b]indol-2-ium-2-yl)pentyl]-1-methyl-9H-pyrido[3,4-b]indol-2-ium dibromide |
| SMILES | COc1ccc2c(c1)[nH]c1c(C)[n+](CCCCC[n+]3ccc4c([nH]c5cc(OC)ccc54)c3C)ccc12.[Br-].[Br-] |
| InChI | InChI=1S/C31H32N4O2.2BrH/c1-20-30-26(24-10-8-22(36-3)18-28(24)32-30)12-16-34(20)14-6-5-7-15-35-17-13-27-25-11-9-23(37-4)19-29(25)33-31(27)21(35)2;;/h8-13,16-19H,5-7,14-15H2,1-4H3;2*1H |
| InChIKey | MVXCHCOUCKUAFI-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 57.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.45 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|