About 3-(hydroxymethyl)-1-methoxy-2-(4-methoxyphenyl)indole-5,6-dicarbonitrile
3-(hydroxymethyl)-1-methoxy-2-(4-methoxyphenyl)indole-5,6-dicarbonitrile (PubChem CID 127046560) has the molecular formula C19H15N3O3
and a molecular weight of 333.35 g/mol. Its IUPAC name is 3-(hydroxymethyl)-1-methoxy-2-(4-methoxyphenyl)indole-5,6-dicarbonitrile.
Molecular Properties
| Compound Name | 3-(hydroxymethyl)-1-methoxy-2-(4-methoxyphenyl)indole-5,6-dicarbonitrile |
| PubChem CID | 127046560 |
| Molecular Formula | C19H15N3O3 |
| Molecular Weight | 333.35 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | 3-(hydroxymethyl)-1-methoxy-2-(4-methoxyphenyl)indole-5,6-dicarbonitrile |
| SMILES | COc1ccc(-c2c(CO)c3cc(C#N)c(C#N)cc3n2OC)cc1 |
| InChI | InChI=1S/C19H15N3O3/c1-24-15-5-3-12(4-6-15)19-17(11-23)16-7-13(9-20)14(10-21)8-18(16)22(19)25-2/h3-8,23H,11H2,1-2H3 |
| InChIKey | BNXHITVJRNAMLS-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 91.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.35 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-(hydroxymethyl)-1-methoxy-2-(4-methoxyphenyl)indole-5,6-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(hydroxymethyl)-1-methoxy-2-(4-methoxyphenyl)indole-5,6-dicarbonitrile?
The IUPAC name of 3-(hydroxymethyl)-1-methoxy-2-(4-methoxyphenyl)indole-5,6-dicarbonitrile (CID 127046560) is 3-(hydroxymethyl)-1-methoxy-2-(4-methoxyphenyl)indole-5,6-dicarbonitrile.
What is the SMILES notation for 3-(hydroxymethyl)-1-methoxy-2-(4-methoxyphenyl)indole-5,6-dicarbonitrile?
The canonical SMILES for 3-(hydroxymethyl)-1-methoxy-2-(4-methoxyphenyl)indole-5,6-dicarbonitrile is COc1ccc(-c2c(CO)c3cc(C#N)c(C#N)cc3n2OC)cc1.
What is the InChIKey of 3-(hydroxymethyl)-1-methoxy-2-(4-methoxyphenyl)indole-5,6-dicarbonitrile?
The InChIKey is BNXHITVJRNAMLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15N3O3/c1-24-15-5-3-12(4-6-15)19-17(11-23)16-7-13(9-20)14(10-21)8-18(16)22(19)25-2/h3-8,23H,11H2,1-2H3.
What are the key properties of 3-(hydroxymethyl)-1-methoxy-2-(4-methoxyphenyl)indole-5,6-dicarbonitrile?
3-(hydroxymethyl)-1-methoxy-2-(4-methoxyphenyl)indole-5,6-dicarbonitrile has a molecular weight of 333.35 g/mol, XLogP of 2.61, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(hydroxymethyl)-1-methoxy-2-(4-methoxyphenyl)indole-5,6-dicarbonitrile is sourced from PubChem (CID 127046560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).