C18H14FN3O3S — CID 127046772
N-[2-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]ethyl]-3-nitrobenzamide (PubChem CID 127046772) has the molecular formula C18H14FN3O3S and a molecular weight of 371.39 g/mol. Its IUPAC name is N-[2-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]ethyl]-3-nitrobenzamide.
| Compound Name | N-[2-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]ethyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 127046772 |
| Molecular Formula | C18H14FN3O3S |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.07 |
| IUPAC Name | N-[2-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]ethyl]-3-nitrobenzamide |
| SMILES | O=C(NCCc1nc(-c2ccc(F)cc2)cs1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H14FN3O3S/c19-14-6-4-12(5-7-14)16-11-26-17(21-16)8-9-20-18(23)13-2-1-3-15(10-13)22(24)25/h1-7,10-11H,8-9H2,(H,20,23) |
| InChIKey | USOLQGMONVYJCS-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|