About 6-methylhept-3-yne-1,5-diol
6-methylhept-3-yne-1,5-diol (PubChem CID 127046777) has the molecular formula C8H14O2
and a molecular weight of 142.20 g/mol. Its IUPAC name is 6-methylhept-3-yne-1,5-diol.
Molecular Properties
| Compound Name | 6-methylhept-3-yne-1,5-diol |
| PubChem CID | 127046777 |
| Molecular Formula | C8H14O2 |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.10 |
| IUPAC Name | 6-methylhept-3-yne-1,5-diol |
| SMILES | CC(C)C(O)C#CCCO |
| InChI | InChI=1S/C8H14O2/c1-7(2)8(10)5-3-4-6-9/h7-10H,4,6H2,1-2H3 |
| InChIKey | FFDMHZPZXUYCTA-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-methylhept-3-yne-1,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methylhept-3-yne-1,5-diol?
The IUPAC name of 6-methylhept-3-yne-1,5-diol (CID 127046777) is 6-methylhept-3-yne-1,5-diol.
What is the SMILES notation for 6-methylhept-3-yne-1,5-diol?
The canonical SMILES for 6-methylhept-3-yne-1,5-diol is CC(C)C(O)C#CCCO.
What is the InChIKey of 6-methylhept-3-yne-1,5-diol?
The InChIKey is FFDMHZPZXUYCTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O2/c1-7(2)8(10)5-3-4-6-9/h7-10H,4,6H2,1-2H3.
What are the key properties of 6-methylhept-3-yne-1,5-diol?
6-methylhept-3-yne-1,5-diol has a molecular weight of 142.20 g/mol, XLogP of 0.39, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methylhept-3-yne-1,5-diol is sourced from PubChem (CID 127046777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).