C26H29N3O2 — CID 127046955
3-[(1R,9R,13R)-4-hydroxy-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]-N-quinolin-3-ylpropanamide (PubChem CID 127046955) has the molecular formula C26H29N3O2 and a molecular weight of 415.54 g/mol. Its IUPAC name is 3-[(1R,9R,13R)-4-hydroxy-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]-N-quinolin-3-ylpropanamide.
| Compound Name | 3-[(1R,9R,13R)-4-hydroxy-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]-N-quinolin-3-ylpropanamide |
|---|---|
| PubChem CID | 127046955 |
| Molecular Formula | C26H29N3O2 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.23 |
| IUPAC Name | 3-[(1R,9R,13R)-4-hydroxy-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]-N-quinolin-3-ylpropanamide |
| SMILES | C[C@H]1[C@H]2Cc3ccc(O)cc3[C@]1(C)CCN2CCC(=O)Nc1cnc2ccccc2c1 |
| InChI | InChI=1S/C26H29N3O2/c1-17-24-14-18-7-8-21(30)15-22(18)26(17,2)10-12-29(24)11-9-25(31)28-20-13-19-5-3-4-6-23(19)27-16-20/h3-8,13,15-17,24,30H,9-12,14H2,1-2H3,(H,28,31)/t17-,24+,26+/m0/s1 |
| InChIKey | VYECARJSDZCAQH-BQVXCWBNSA-N |
| XLogP | 4.49 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |