C27H32F2N6O3 — CID 127046990
methyl 2-[3-[[1-(6,6-difluoro-5,7,8,9-tetrahydropyrimido[4,5-b]indol-4-yl)-4-(dimethylamino)piperidine-4-carbonyl]amino]phenyl]acetate (PubChem CID 127046990) has the molecular formula C27H32F2N6O3 and a molecular weight of 526.59 g/mol. Its IUPAC name is methyl 2-[3-[[1-(6,6-difluoro-5,7,8,9-tetrahydropyrimido[4,5-b]indol-4-yl)-4-(dimethylamino)piperidine-4-carbonyl]amino]phenyl]acetate.
| Compound Name | methyl 2-[3-[[1-(6,6-difluoro-5,7,8,9-tetrahydropyrimido[4,5-b]indol-4-yl)-4-(dimethylamino)piperidine-4-carbonyl]amino]phenyl]acetate |
|---|---|
| PubChem CID | 127046990 |
| Molecular Formula | C27H32F2N6O3 |
| Molecular Weight | 526.59 g/mol |
| Exact Mass | 526.25 |
| IUPAC Name | methyl 2-[3-[[1-(6,6-difluoro-5,7,8,9-tetrahydropyrimido[4,5-b]indol-4-yl)-4-(dimethylamino)piperidine-4-carbonyl]amino]phenyl]acetate |
| SMILES | COC(=O)Cc1cccc(NC(=O)C2(N(C)C)CCN(c3ncnc4[nH]c5c(c34)CC(F)(F)CC5)CC2)c1 |
| InChI | InChI=1S/C27H32F2N6O3/c1-34(2)26(25(37)32-18-6-4-5-17(13-18)14-21(36)38-3)9-11-35(12-10-26)24-22-19-15-27(28,29)8-7-20(19)33-23(22)30-16-31-24/h4-6,13,16H,7-12,14-15H2,1-3H3,(H,32,37)(H,30,31,33) |
| InChIKey | DTVFQHOXYKFHFO-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 103.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.59 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |