About N-[(2,4-dichloro-3-fluorophenyl)methyl]-3-pyridin-4-yl-1H-indazole-5-carboxamide
N-[(2,4-dichloro-3-fluorophenyl)methyl]-3-pyridin-4-yl-1H-indazole-5-carboxamide (PubChem CID 127047018) has the molecular formula C20H13Cl2FN4O
and a molecular weight of 415.26 g/mol. Its IUPAC name is N-[(2,4-dichloro-3-fluorophenyl)methyl]-3-pyridin-4-yl-1H-indazole-5-carboxamide.
Molecular Properties
| Compound Name | N-[(2,4-dichloro-3-fluorophenyl)methyl]-3-pyridin-4-yl-1H-indazole-5-carboxamide |
| PubChem CID | 127047018 |
| Molecular Formula | C20H13Cl2FN4O |
| Molecular Weight | 415.26 g/mol |
| Exact Mass | 414.05 |
| IUPAC Name | N-[(2,4-dichloro-3-fluorophenyl)methyl]-3-pyridin-4-yl-1H-indazole-5-carboxamide |
| SMILES | O=C(NCc1ccc(Cl)c(F)c1Cl)c1ccc2[nH]nc(-c3ccncc3)c2c1 |
| InChI | InChI=1S/C20H13Cl2FN4O/c21-15-3-1-13(17(22)18(15)23)10-25-20(28)12-2-4-16-14(9-12)19(27-26-16)11-5-7-24-8-6-11/h1-9H,10H2,(H,25,28)(H,26,27) |
| InChIKey | XCHPMRIRNSGKEK-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 415.26 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze N-[(2,4-dichloro-3-fluorophenyl)methyl]-3-pyridin-4-yl-1H-indazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2,4-dichloro-3-fluorophenyl)methyl]-3-pyridin-4-yl-1H-indazole-5-carboxamide?
The IUPAC name of N-[(2,4-dichloro-3-fluorophenyl)methyl]-3-pyridin-4-yl-1H-indazole-5-carboxamide (CID 127047018) is N-[(2,4-dichloro-3-fluorophenyl)methyl]-3-pyridin-4-yl-1H-indazole-5-carboxamide.
What is the SMILES notation for N-[(2,4-dichloro-3-fluorophenyl)methyl]-3-pyridin-4-yl-1H-indazole-5-carboxamide?
The canonical SMILES for N-[(2,4-dichloro-3-fluorophenyl)methyl]-3-pyridin-4-yl-1H-indazole-5-carboxamide is O=C(NCc1ccc(Cl)c(F)c1Cl)c1ccc2[nH]nc(-c3ccncc3)c2c1.
What is the InChIKey of N-[(2,4-dichloro-3-fluorophenyl)methyl]-3-pyridin-4-yl-1H-indazole-5-carboxamide?
The InChIKey is XCHPMRIRNSGKEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H13Cl2FN4O/c21-15-3-1-13(17(22)18(15)23)10-25-20(28)12-2-4-16-14(9-12)19(27-26-16)11-5-7-24-8-6-11/h1-9H,10H2,(H,25,28)(H,26,27).
What are the key properties of N-[(2,4-dichloro-3-fluorophenyl)methyl]-3-pyridin-4-yl-1H-indazole-5-carboxamide?
N-[(2,4-dichloro-3-fluorophenyl)methyl]-3-pyridin-4-yl-1H-indazole-5-carboxamide has a molecular weight of 415.26 g/mol, XLogP of 5.00, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2,4-dichloro-3-fluorophenyl)methyl]-3-pyridin-4-yl-1H-indazole-5-carboxamide is sourced from PubChem (CID 127047018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).