C35H33N3O8 — CID 127047288
4-[3-[4-[[4-[(1E,4E)-5-(3,4-dimethoxyphenyl)-3-oxopenta-1,4-dienyl]-2-methoxyphenoxy]methyl]triazol-1-yl]propoxy]chromen-2-one (PubChem CID 127047288) has the molecular formula C35H33N3O8 and a molecular weight of 623.66 g/mol. Its IUPAC name is 4-[3-[4-[[4-[(1E,4E)-5-(3,4-dimethoxyphenyl)-3-oxopenta-1,4-dienyl]-2-methoxyphenoxy]methyl]triazol-1-yl]propoxy]chromen-2-one.
| Compound Name | 4-[3-[4-[[4-[(1E,4E)-5-(3,4-dimethoxyphenyl)-3-oxopenta-1,4-dienyl]-2-methoxyphenoxy]methyl]triazol-1-yl]propoxy]chromen-2-one |
|---|---|
| PubChem CID | 127047288 |
| Molecular Formula | C35H33N3O8 |
| Molecular Weight | 623.66 g/mol |
| Exact Mass | 623.23 |
| IUPAC Name | 4-[3-[4-[[4-[(1E,4E)-5-(3,4-dimethoxyphenyl)-3-oxopenta-1,4-dienyl]-2-methoxyphenoxy]methyl]triazol-1-yl]propoxy]chromen-2-one |
| SMILES | COc1ccc(/C=C/C(=O)/C=C/c2ccc(OCc3cn(CCCOc4cc(=O)oc5ccccc45)nn3)c(OC)c2)cc1OC |
| InChI | InChI=1S/C35H33N3O8/c1-41-30-15-11-24(19-33(30)42-2)9-13-27(39)14-10-25-12-16-31(34(20-25)43-3)45-23-26-22-38(37-36-26)17-6-18-44-32-21-35(40)46-29-8-5-4-7-28(29)32/h4-5,7-16,19-22H,6,17-18,23H2,1-3H3/b13-9+,14-10+ |
| InChIKey | KDVSCDPELICBPB-UTLPMFLDSA-N |
| XLogP | 5.75 |
| TPSA | 124.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.66 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|