C19H20N6O3 — CID 127047374
N-[2-(4-methylpiperazin-1-yl)-5-nitrophenyl]-1H-indazole-6-carboxamide (PubChem CID 127047374) has the molecular formula C19H20N6O3 and a molecular weight of 380.41 g/mol. Its IUPAC name is N-[2-(4-methylpiperazin-1-yl)-5-nitrophenyl]-1H-indazole-6-carboxamide.
| Compound Name | N-[2-(4-methylpiperazin-1-yl)-5-nitrophenyl]-1H-indazole-6-carboxamide |
|---|---|
| PubChem CID | 127047374 |
| Molecular Formula | C19H20N6O3 |
| Molecular Weight | 380.41 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | N-[2-(4-methylpiperazin-1-yl)-5-nitrophenyl]-1H-indazole-6-carboxamide |
| SMILES | CN1CCN(c2ccc([N+](=O)[O-])cc2NC(=O)c2ccc3cn[nH]c3c2)CC1 |
| InChI | InChI=1S/C19H20N6O3/c1-23-6-8-24(9-7-23)18-5-4-15(25(27)28)11-17(18)21-19(26)13-2-3-14-12-20-22-16(14)10-13/h2-5,10-12H,6-9H2,1H3,(H,20,22)(H,21,26) |
| InChIKey | NTDQAEZSSGIFJT-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 107.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.41 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|