C21H20N2O4 — CID 127047406
3'-(4-ethylphenyl)-1'-propylspiro[2-benzofuran-3,5'-imidazolidine]-1,2',4'-trione (PubChem CID 127047406) has the molecular formula C21H20N2O4 and a molecular weight of 364.40 g/mol. Its IUPAC name is 3'-(4-ethylphenyl)-1'-propylspiro[2-benzofuran-3,5'-imidazolidine]-1,2',4'-trione.
| Compound Name | 3'-(4-ethylphenyl)-1'-propylspiro[2-benzofuran-3,5'-imidazolidine]-1,2',4'-trione |
|---|---|
| PubChem CID | 127047406 |
| Molecular Formula | C21H20N2O4 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | 3'-(4-ethylphenyl)-1'-propylspiro[2-benzofuran-3,5'-imidazolidine]-1,2',4'-trione |
| SMILES | CCCN1C(=O)N(c2ccc(CC)cc2)C(=O)C12OC(=O)c1ccccc12 |
| InChI | InChI=1S/C21H20N2O4/c1-3-13-22-20(26)23(15-11-9-14(4-2)10-12-15)19(25)21(22)17-8-6-5-7-16(17)18(24)27-21/h5-12H,3-4,13H2,1-2H3 |
| InChIKey | NBRQZHMZQCICPS-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|