C17H27NO8S — CID 127047415
N-[(2S)-2-hydroxy-2-[(2R,3S,4S,5S,6S)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]ethyl]-2,4,6-trimethylbenzenesulfonamide (PubChem CID 127047415) has the molecular formula C17H27NO8S and a molecular weight of 405.47 g/mol. Its IUPAC name is N-[(2S)-2-hydroxy-2-[(2R,3S,4S,5S,6S)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]ethyl]-2,4,6-trimethylbenzenesulfonamide.
| Compound Name | N-[(2S)-2-hydroxy-2-[(2R,3S,4S,5S,6S)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]ethyl]-2,4,6-trimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 127047415 |
| Molecular Formula | C17H27NO8S |
| Molecular Weight | 405.47 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | N-[(2S)-2-hydroxy-2-[(2R,3S,4S,5S,6S)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]ethyl]-2,4,6-trimethylbenzenesulfonamide |
| SMILES | CO[C@H]1O[C@H]([C@@H](O)CNS(=O)(=O)c2c(C)cc(C)cc2C)[C@@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C17H27NO8S/c1-8-5-9(2)16(10(3)6-8)27(23,24)18-7-11(19)15-13(21)12(20)14(22)17(25-4)26-15/h5-6,11-15,17-22H,7H2,1-4H3/t11-,12-,13-,14-,15+,17-/m0/s1 |
| InChIKey | PYUNBLYZSIWBJL-HPEALNBZSA-N |
| XLogP | -1.29 |
| TPSA | 145.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.47 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |