C33H29N3O7 — CID 127047701
4-[2-[4-[[2-methoxy-4-[(1E,4E)-5-(2-methoxyphenyl)-3-oxopenta-1,4-dienyl]phenoxy]methyl]triazol-1-yl]ethoxy]chromen-2-one (PubChem CID 127047701) has the molecular formula C33H29N3O7 and a molecular weight of 579.61 g/mol. Its IUPAC name is 4-[2-[4-[[2-methoxy-4-[(1E,4E)-5-(2-methoxyphenyl)-3-oxopenta-1,4-dienyl]phenoxy]methyl]triazol-1-yl]ethoxy]chromen-2-one.
| Compound Name | 4-[2-[4-[[2-methoxy-4-[(1E,4E)-5-(2-methoxyphenyl)-3-oxopenta-1,4-dienyl]phenoxy]methyl]triazol-1-yl]ethoxy]chromen-2-one |
|---|---|
| PubChem CID | 127047701 |
| Molecular Formula | C33H29N3O7 |
| Molecular Weight | 579.61 g/mol |
| Exact Mass | 579.20 |
| IUPAC Name | 4-[2-[4-[[2-methoxy-4-[(1E,4E)-5-(2-methoxyphenyl)-3-oxopenta-1,4-dienyl]phenoxy]methyl]triazol-1-yl]ethoxy]chromen-2-one |
| SMILES | COc1ccccc1/C=C/C(=O)/C=C/c1ccc(OCc2cn(CCOc3cc(=O)oc4ccccc34)nn2)c(OC)c1 |
| InChI | InChI=1S/C33H29N3O7/c1-39-28-9-5-3-7-24(28)13-15-26(37)14-11-23-12-16-30(32(19-23)40-2)42-22-25-21-36(35-34-25)17-18-41-31-20-33(38)43-29-10-6-4-8-27(29)31/h3-16,19-21H,17-18,22H2,1-2H3/b14-11+,15-13+ |
| InChIKey | FYVVURUFXBURBP-KFWRFBQVSA-N |
| XLogP | 5.36 |
| TPSA | 114.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.61 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|