C26H34N6O3 — CID 127047801
4-[4-(2,2-dimethylpropanoylamino)phenyl]-7-methyl-N-(3-morpholin-4-ylpropyl)pyrrolo[2,3-d]pyrimidine-6-carboxamide (PubChem CID 127047801) has the molecular formula C26H34N6O3 and a molecular weight of 478.60 g/mol. Its IUPAC name is 4-[4-(2,2-dimethylpropanoylamino)phenyl]-7-methyl-N-(3-morpholin-4-ylpropyl)pyrrolo[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | 4-[4-(2,2-dimethylpropanoylamino)phenyl]-7-methyl-N-(3-morpholin-4-ylpropyl)pyrrolo[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 127047801 |
| Molecular Formula | C26H34N6O3 |
| Molecular Weight | 478.60 g/mol |
| Exact Mass | 478.27 |
| IUPAC Name | 4-[4-(2,2-dimethylpropanoylamino)phenyl]-7-methyl-N-(3-morpholin-4-ylpropyl)pyrrolo[2,3-d]pyrimidine-6-carboxamide |
| SMILES | Cn1c(C(=O)NCCCN2CCOCC2)cc2c(-c3ccc(NC(=O)C(C)(C)C)cc3)ncnc21 |
| InChI | InChI=1S/C26H34N6O3/c1-26(2,3)25(34)30-19-8-6-18(7-9-19)22-20-16-21(31(4)23(20)29-17-28-22)24(33)27-10-5-11-32-12-14-35-15-13-32/h6-9,16-17H,5,10-15H2,1-4H3,(H,27,33)(H,30,34) |
| InChIKey | ZASOBZCIMVEQFU-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.60 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|