C25H27N3O4 — CID 127047902
2-(1,3-benzodioxol-5-yl)-N-tert-butyl-2-(4-oxo-1,2,5,6-tetrahydroazepino[4,5-b]indol-3-yl)acetamide (PubChem CID 127047902) has the molecular formula C25H27N3O4 and a molecular weight of 433.51 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-N-tert-butyl-2-(4-oxo-1,2,5,6-tetrahydroazepino[4,5-b]indol-3-yl)acetamide.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-N-tert-butyl-2-(4-oxo-1,2,5,6-tetrahydroazepino[4,5-b]indol-3-yl)acetamide |
|---|---|
| PubChem CID | 127047902 |
| Molecular Formula | C25H27N3O4 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-N-tert-butyl-2-(4-oxo-1,2,5,6-tetrahydroazepino[4,5-b]indol-3-yl)acetamide |
| SMILES | CC(C)(C)NC(=O)C(c1ccc2c(c1)OCO2)N1CCc2c([nH]c3ccccc23)CC1=O |
| InChI | InChI=1S/C25H27N3O4/c1-25(2,3)27-24(30)23(15-8-9-20-21(12-15)32-14-31-20)28-11-10-17-16-6-4-5-7-18(16)26-19(17)13-22(28)29/h4-9,12,23,26H,10-11,13-14H2,1-3H3,(H,27,30) |
| InChIKey | RLSLDGQGGMQYGX-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 83.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|