C29H38N2O3 — CID 127047948
methyl (2R)-2-[[(1R,4aS,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carbonyl]amino]-3-pyridin-3-ylpropanoate (PubChem CID 127047948) has the molecular formula C29H38N2O3 and a molecular weight of 462.63 g/mol. Its IUPAC name is methyl (2R)-2-[[(1R,4aS,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carbonyl]amino]-3-pyridin-3-ylpropanoate.
| Compound Name | methyl (2R)-2-[[(1R,4aS,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carbonyl]amino]-3-pyridin-3-ylpropanoate |
|---|---|
| PubChem CID | 127047948 |
| Molecular Formula | C29H38N2O3 |
| Molecular Weight | 462.63 g/mol |
| Exact Mass | 462.29 |
| IUPAC Name | methyl (2R)-2-[[(1R,4aS,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carbonyl]amino]-3-pyridin-3-ylpropanoate |
| SMILES | COC(=O)[C@@H](Cc1cccnc1)NC(=O)[C@]1(C)CCC[C@]2(C)c3ccc(C(C)C)cc3CC[C@@H]12 |
| InChI | InChI=1S/C29H38N2O3/c1-19(2)21-9-11-23-22(17-21)10-12-25-28(23,3)13-7-14-29(25,4)27(33)31-24(26(32)34-5)16-20-8-6-15-30-18-20/h6,8-9,11,15,17-19,24-25H,7,10,12-14,16H2,1-5H3,(H,31,33)/t24-,25-,28-,29-/m1/s1 |
| InChIKey | XOCFDEXNEAXKSM-WPUBFDFZSA-N |
| XLogP | 5.12 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.63 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |