C21H36N2 — CID 127048173
(1R,2S,9R,10R)-3-hexyl-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-ene (PubChem CID 127048173) has the molecular formula C21H36N2 and a molecular weight of 316.53 g/mol. Its IUPAC name is (1R,2S,9R,10R)-3-hexyl-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-ene.
| Compound Name | (1R,2S,9R,10R)-3-hexyl-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-ene |
|---|---|
| PubChem CID | 127048173 |
| Molecular Formula | C21H36N2 |
| Molecular Weight | 316.53 g/mol |
| Exact Mass | 316.29 |
| IUPAC Name | (1R,2S,9R,10R)-3-hexyl-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-ene |
| SMILES | CCCCCCN1CCCC2=C[C@H]3C[C@H](CN4CCCC[C@H]34)[C@@H]21 |
| InChI | InChI=1S/C21H36N2/c1-2-3-4-6-11-22-13-8-9-17-14-18-15-19(21(17)22)16-23-12-7-5-10-20(18)23/h14,18-21H,2-13,15-16H2,1H3/t18-,19+,20+,21+/m0/s1 |
| InChIKey | IXCWLWUUQCXOOT-DOIPELPJSA-N |
| XLogP | 4.46 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.53 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|