C13H16N4OS — CID 127048216
(2Z)-3-[(4-aminophenyl)methyl]-2-(propan-2-ylidenehydrazinylidene)-1,3-thiazolidin-4-one (PubChem CID 127048216) has the molecular formula C13H16N4OS and a molecular weight of 276.37 g/mol. Its IUPAC name is (2Z)-3-[(4-aminophenyl)methyl]-2-(propan-2-ylidenehydrazinylidene)-1,3-thiazolidin-4-one.
| Compound Name | (2Z)-3-[(4-aminophenyl)methyl]-2-(propan-2-ylidenehydrazinylidene)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 127048216 |
| Molecular Formula | C13H16N4OS |
| Molecular Weight | 276.37 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | (2Z)-3-[(4-aminophenyl)methyl]-2-(propan-2-ylidenehydrazinylidene)-1,3-thiazolidin-4-one |
| SMILES | CC(C)=N/N=C1\SCC(=O)N1Cc1ccc(N)cc1 |
| InChI | InChI=1S/C13H16N4OS/c1-9(2)15-16-13-17(12(18)8-19-13)7-10-3-5-11(14)6-4-10/h3-6H,7-8,14H2,1-2H3/b16-13- |
| InChIKey | GGQSYUZYBFPVDG-SSZFMOIBSA-N |
| XLogP | 2.10 |
| TPSA | 71.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.37 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|