C31H27N3O8 — CID 127048262
[15-methoxy-20-(3-morpholin-4-ylpropyl)-11,19-dioxo-5,7-dioxa-20-azapentacyclo[10.8.0.02,10.04,8.013,18]icosa-1(12),2,4(8),9,13,15,17-heptaen-16-yl] pyridine-3-carboxylate (PubChem CID 127048262) has the molecular formula C31H27N3O8 and a molecular weight of 569.57 g/mol. Its IUPAC name is [15-methoxy-20-(3-morpholin-4-ylpropyl)-11,19-dioxo-5,7-dioxa-20-azapentacyclo[10.8.0.02,10.04,8.013,18]icosa-1(12),2,4(8),9,13,15,17-heptaen-16-yl] pyridine-3-carboxylate.
| Compound Name | [15-methoxy-20-(3-morpholin-4-ylpropyl)-11,19-dioxo-5,7-dioxa-20-azapentacyclo[10.8.0.02,10.04,8.013,18]icosa-1(12),2,4(8),9,13,15,17-heptaen-16-yl] pyridine-3-carboxylate |
|---|---|
| PubChem CID | 127048262 |
| Molecular Formula | C31H27N3O8 |
| Molecular Weight | 569.57 g/mol |
| Exact Mass | 569.18 |
| IUPAC Name | [15-methoxy-20-(3-morpholin-4-ylpropyl)-11,19-dioxo-5,7-dioxa-20-azapentacyclo[10.8.0.02,10.04,8.013,18]icosa-1(12),2,4(8),9,13,15,17-heptaen-16-yl] pyridine-3-carboxylate |
| SMILES | COc1cc2c3c(n(CCCN4CCOCC4)c(=O)c2cc1OC(=O)c1cccnc1)-c1cc2c(cc1C3=O)OCO2 |
| InChI | InChI=1S/C31H27N3O8/c1-38-23-12-19-22(15-26(23)42-31(37)18-4-2-5-32-16-18)30(36)34(7-3-6-33-8-10-39-11-9-33)28-20-13-24-25(41-17-40-24)14-21(20)29(35)27(19)28/h2,4-5,12-16H,3,6-11,17H2,1H3 |
| InChIKey | VHDINJFKLCWLMC-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 118.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.57 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'keto_phenone_A(11)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|