C24H25FN2O5 — CID 127048266
(3Z)-3-[[4-[2-(2,6-dimethylmorpholin-4-yl)-2-oxoethoxy]-3-methoxyphenyl]methylidene]-5-fluoro-1H-indol-2-one (PubChem CID 127048266) has the molecular formula C24H25FN2O5 and a molecular weight of 440.47 g/mol. Its IUPAC name is (3Z)-3-[[4-[2-(2,6-dimethylmorpholin-4-yl)-2-oxoethoxy]-3-methoxyphenyl]methylidene]-5-fluoro-1H-indol-2-one.
| Compound Name | (3Z)-3-[[4-[2-(2,6-dimethylmorpholin-4-yl)-2-oxoethoxy]-3-methoxyphenyl]methylidene]-5-fluoro-1H-indol-2-one |
|---|---|
| PubChem CID | 127048266 |
| Molecular Formula | C24H25FN2O5 |
| Molecular Weight | 440.47 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | (3Z)-3-[[4-[2-(2,6-dimethylmorpholin-4-yl)-2-oxoethoxy]-3-methoxyphenyl]methylidene]-5-fluoro-1H-indol-2-one |
| SMILES | COc1cc(/C=C2\C(=O)Nc3ccc(F)cc32)ccc1OCC(=O)N1CC(C)OC(C)C1 |
| InChI | InChI=1S/C24H25FN2O5/c1-14-11-27(12-15(2)32-14)23(28)13-31-21-7-4-16(9-22(21)30-3)8-19-18-10-17(25)5-6-20(18)26-24(19)29/h4-10,14-15H,11-13H2,1-3H3,(H,26,29)/b19-8- |
| InChIKey | NQPUBXCSAOHMDA-UWVJOHFNSA-N |
| XLogP | 3.34 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.47 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|