C14H29ClO6S — CID 127048314
(2R,3S,4S)-1-[(2S,3S)-3-(2,2-dimethylpropoxy)-2,4-dihydroxybutyl]-2-(hydroxymethyl)thiolan-1-ium-3,4-diol chloride (PubChem CID 127048314) has the molecular formula C14H29ClO6S and a molecular weight of 360.90 g/mol. Its IUPAC name is (2R,3S,4S)-1-[(2S,3S)-3-(2,2-dimethylpropoxy)-2,4-dihydroxybutyl]-2-(hydroxymethyl)thiolan-1-ium-3,4-diol chloride.
| Compound Name | (2R,3S,4S)-1-[(2S,3S)-3-(2,2-dimethylpropoxy)-2,4-dihydroxybutyl]-2-(hydroxymethyl)thiolan-1-ium-3,4-diol chloride |
|---|---|
| PubChem CID | 127048314 |
| Molecular Formula | C14H29ClO6S |
| Molecular Weight | 360.90 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | (2R,3S,4S)-1-[(2S,3S)-3-(2,2-dimethylpropoxy)-2,4-dihydroxybutyl]-2-(hydroxymethyl)thiolan-1-ium-3,4-diol chloride |
| SMILES | CC(C)(C)CO[C@@H](CO)[C@H](O)C[S+]1C[C@@H](O)[C@H](O)[C@H]1CO.[Cl-] |
| InChI | InChI=1S/C14H29O6S.ClH/c1-14(2,3)8-20-11(4-15)9(17)6-21-7-10(18)13(19)12(21)5-16;/h9-13,15-19H,4-8H2,1-3H3;1H/q+1;/p-1/t9-,10-,11+,12-,13+,21?;/m1./s1 |
| InChIKey | DVAAJVOJECLOJO-UEQGRHGPSA-M |
| XLogP | -4.51 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.90 |
| LogP ≤ 5 | -4.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|