C14H20N6O2S — CID 127048326
(2R,3R,4S)-2-(6-amino-8-piperidin-1-ylpurin-9-yl)thiolane-3,4-diol (PubChem CID 127048326) has the molecular formula C14H20N6O2S and a molecular weight of 336.42 g/mol. Its IUPAC name is (2R,3R,4S)-2-(6-amino-8-piperidin-1-ylpurin-9-yl)thiolane-3,4-diol.
| Compound Name | (2R,3R,4S)-2-(6-amino-8-piperidin-1-ylpurin-9-yl)thiolane-3,4-diol |
|---|---|
| PubChem CID | 127048326 |
| Molecular Formula | C14H20N6O2S |
| Molecular Weight | 336.42 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | (2R,3R,4S)-2-(6-amino-8-piperidin-1-ylpurin-9-yl)thiolane-3,4-diol |
| SMILES | Nc1ncnc2c1nc(N1CCCCC1)n2[C@@H]1SC[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C14H20N6O2S/c15-11-9-12(17-7-16-11)20(13-10(22)8(21)6-23-13)14(18-9)19-4-2-1-3-5-19/h7-8,10,13,21-22H,1-6H2,(H2,15,16,17)/t8-,10-,13-/m1/s1 |
| InChIKey | PEVRFFGNXWTQLO-ZDSQKVDBSA-N |
| XLogP | 0.37 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.42 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |