C15H10FN3O2S — CID 127048344
8-fluoro-4-oxo-N-[(E)-thiophen-2-ylmethylideneamino]-1H-quinoline-3-carboxamide (PubChem CID 127048344) has the molecular formula C15H10FN3O2S and a molecular weight of 315.33 g/mol. Its IUPAC name is 8-fluoro-4-oxo-N-[(E)-thiophen-2-ylmethylideneamino]-1H-quinoline-3-carboxamide.
| Compound Name | 8-fluoro-4-oxo-N-[(E)-thiophen-2-ylmethylideneamino]-1H-quinoline-3-carboxamide |
|---|---|
| PubChem CID | 127048344 |
| Molecular Formula | C15H10FN3O2S |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.05 |
| IUPAC Name | 8-fluoro-4-oxo-N-[(E)-thiophen-2-ylmethylideneamino]-1H-quinoline-3-carboxamide |
| SMILES | O=C(N/N=C/c1cccs1)c1c[nH]c2c(F)cccc2c1=O |
| InChI | InChI=1S/C15H10FN3O2S/c16-12-5-1-4-10-13(12)17-8-11(14(10)20)15(21)19-18-7-9-3-2-6-22-9/h1-8H,(H,17,20)(H,19,21)/b18-7+ |
| InChIKey | JNFQKKPHDNYFMO-CNHKJKLMSA-N |
| XLogP | 2.49 |
| TPSA | 74.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|