C27H22F10N2O3 — CID 127048513
(2S)-1,1,1-trifluoro-3-[(2S)-2-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-4-[[3-(trifluoromethoxy)phenyl]methyl]-2,3-dihydroquinoxalin-1-yl]propan-2-ol (PubChem CID 127048513) has the molecular formula C27H22F10N2O3 and a molecular weight of 612.46 g/mol. Its IUPAC name is (2S)-1,1,1-trifluoro-3-[(2S)-2-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-4-[[3-(trifluoromethoxy)phenyl]methyl]-2,3-dihydroquinoxalin-1-yl]propan-2-ol.
| Compound Name | (2S)-1,1,1-trifluoro-3-[(2S)-2-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-4-[[3-(trifluoromethoxy)phenyl]methyl]-2,3-dihydroquinoxalin-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 127048513 |
| Molecular Formula | C27H22F10N2O3 |
| Molecular Weight | 612.46 g/mol |
| Exact Mass | 612.15 |
| IUPAC Name | (2S)-1,1,1-trifluoro-3-[(2S)-2-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-4-[[3-(trifluoromethoxy)phenyl]methyl]-2,3-dihydroquinoxalin-1-yl]propan-2-ol |
| SMILES | O[C@@H](CN1c2ccccc2N(Cc2cccc(OC(F)(F)F)c2)C[C@@H]1c1cccc(OC(F)(F)C(F)F)c1)C(F)(F)F |
| InChI | InChI=1S/C27H22F10N2O3/c28-24(29)26(33,34)41-19-8-4-6-17(12-19)22-14-38(13-16-5-3-7-18(11-16)42-27(35,36)37)20-9-1-2-10-21(20)39(22)15-23(40)25(30,31)32/h1-12,22-24,40H,13-15H2/t22-,23+/m1/s1 |
| InChIKey | GDNSSRQMBNDMMX-PKTZIBPZSA-N |
| XLogP | 7.31 |
| TPSA | 45.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.46 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|