C30H40N2O4 — CID 127048541
ethyl (3S,4R,5S)-1-benzyl-2-oxo-4-phenyl-5-(2,2,6,6-tetramethylpiperidin-1-yl)oxypiperidine-3-carboxylate (PubChem CID 127048541) has the molecular formula C30H40N2O4 and a molecular weight of 492.66 g/mol. Its IUPAC name is ethyl (3S,4R,5S)-1-benzyl-2-oxo-4-phenyl-5-(2,2,6,6-tetramethylpiperidin-1-yl)oxypiperidine-3-carboxylate.
| Compound Name | ethyl (3S,4R,5S)-1-benzyl-2-oxo-4-phenyl-5-(2,2,6,6-tetramethylpiperidin-1-yl)oxypiperidine-3-carboxylate |
|---|---|
| PubChem CID | 127048541 |
| Molecular Formula | C30H40N2O4 |
| Molecular Weight | 492.66 g/mol |
| Exact Mass | 492.30 |
| IUPAC Name | ethyl (3S,4R,5S)-1-benzyl-2-oxo-4-phenyl-5-(2,2,6,6-tetramethylpiperidin-1-yl)oxypiperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1C(=O)N(Cc2ccccc2)C[C@@H](ON2C(C)(C)CCCC2(C)C)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C30H40N2O4/c1-6-35-28(34)26-25(23-16-11-8-12-17-23)24(36-32-29(2,3)18-13-19-30(32,4)5)21-31(27(26)33)20-22-14-9-7-10-15-22/h7-12,14-17,24-26H,6,13,18-21H2,1-5H3/t24-,25-,26+/m1/s1 |
| InChIKey | NQUXAKLFZOADGB-CYXNTTPDSA-N |
| XLogP | 5.34 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.66 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|