C26H20F9NO3 — CID 127048562
(2R)-3-[3-benzyl-5-(trifluoromethoxy)-3-[3-(trifluoromethoxy)phenyl]-2H-indol-1-yl]-1,1,1-trifluoropropan-2-ol (PubChem CID 127048562) has the molecular formula C26H20F9NO3 and a molecular weight of 565.43 g/mol. Its IUPAC name is (2R)-3-[3-benzyl-5-(trifluoromethoxy)-3-[3-(trifluoromethoxy)phenyl]-2H-indol-1-yl]-1,1,1-trifluoropropan-2-ol.
| Compound Name | (2R)-3-[3-benzyl-5-(trifluoromethoxy)-3-[3-(trifluoromethoxy)phenyl]-2H-indol-1-yl]-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 127048562 |
| Molecular Formula | C26H20F9NO3 |
| Molecular Weight | 565.43 g/mol |
| Exact Mass | 565.13 |
| IUPAC Name | (2R)-3-[3-benzyl-5-(trifluoromethoxy)-3-[3-(trifluoromethoxy)phenyl]-2H-indol-1-yl]-1,1,1-trifluoropropan-2-ol |
| SMILES | O[C@H](CN1CC(Cc2ccccc2)(c2cccc(OC(F)(F)F)c2)c2cc(OC(F)(F)F)ccc21)C(F)(F)F |
| InChI | InChI=1S/C26H20F9NO3/c27-24(28,29)22(37)14-36-15-23(13-16-5-2-1-3-6-16,17-7-4-8-18(11-17)38-25(30,31)32)20-12-19(9-10-21(20)36)39-26(33,34)35/h1-12,22,37H,13-15H2/t22-,23?/m1/s1 |
| InChIKey | HWAIBXDGGCLWIQ-WTQRLHSKSA-N |
| XLogP | 6.76 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.43 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|