About (3E)-5,7-dichloro-3-[[2-(dimethylamino)pyrimidin-5-yl]methylidene]chromen-4-one
(3E)-5,7-dichloro-3-[[2-(dimethylamino)pyrimidin-5-yl]methylidene]chromen-4-one (PubChem CID 127048829) has the molecular formula C16H13Cl2N3O2
and a molecular weight of 350.21 g/mol. Its IUPAC name is (3E)-5,7-dichloro-3-[[2-(dimethylamino)pyrimidin-5-yl]methylidene]chromen-4-one.
Molecular Properties
| Compound Name | (3E)-5,7-dichloro-3-[[2-(dimethylamino)pyrimidin-5-yl]methylidene]chromen-4-one |
| PubChem CID | 127048829 |
| Molecular Formula | C16H13Cl2N3O2 |
| Molecular Weight | 350.21 g/mol |
| Exact Mass | 349.04 |
| IUPAC Name | (3E)-5,7-dichloro-3-[[2-(dimethylamino)pyrimidin-5-yl]methylidene]chromen-4-one |
| SMILES | CN(C)c1ncc(/C=C2\COc3cc(Cl)cc(Cl)c3C2=O)cn1 |
| InChI | InChI=1S/C16H13Cl2N3O2/c1-21(2)16-19-6-9(7-20-16)3-10-8-23-13-5-11(17)4-12(18)14(13)15(10)22/h3-7H,8H2,1-2H3/b10-3+ |
| InChIKey | APOSPQWHQSODCD-XCVCLJGOSA-N |
| XLogP | 3.51 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.21 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (3E)-5,7-dichloro-3-[[2-(dimethylamino)pyrimidin-5-yl]methylidene]chromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-5,7-dichloro-3-[[2-(dimethylamino)pyrimidin-5-yl]methylidene]chromen-4-one?
The IUPAC name of (3E)-5,7-dichloro-3-[[2-(dimethylamino)pyrimidin-5-yl]methylidene]chromen-4-one (CID 127048829) is (3E)-5,7-dichloro-3-[[2-(dimethylamino)pyrimidin-5-yl]methylidene]chromen-4-one.
What is the SMILES notation for (3E)-5,7-dichloro-3-[[2-(dimethylamino)pyrimidin-5-yl]methylidene]chromen-4-one?
The canonical SMILES for (3E)-5,7-dichloro-3-[[2-(dimethylamino)pyrimidin-5-yl]methylidene]chromen-4-one is CN(C)c1ncc(/C=C2\COc3cc(Cl)cc(Cl)c3C2=O)cn1.
What is the InChIKey of (3E)-5,7-dichloro-3-[[2-(dimethylamino)pyrimidin-5-yl]methylidene]chromen-4-one?
The InChIKey is APOSPQWHQSODCD-XCVCLJGOSA-N. The full InChI is InChI=1S/C16H13Cl2N3O2/c1-21(2)16-19-6-9(7-20-16)3-10-8-23-13-5-11(17)4-12(18)14(13)15(10)22/h3-7H,8H2,1-2H3/b10-3+.
What are the key properties of (3E)-5,7-dichloro-3-[[2-(dimethylamino)pyrimidin-5-yl]methylidene]chromen-4-one?
(3E)-5,7-dichloro-3-[[2-(dimethylamino)pyrimidin-5-yl]methylidene]chromen-4-one has a molecular weight of 350.21 g/mol, XLogP of 3.51, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-5,7-dichloro-3-[[2-(dimethylamino)pyrimidin-5-yl]methylidene]chromen-4-one is sourced from PubChem (CID 127048829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).