C30H36N4O6 — CID 127048846
[(3S,8R,9S,10R,13S,14S)-10,13-dimethyl-17-oxo-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl] 2-[4-[(2-nitrophenoxy)methyl]triazol-1-yl]acetate (PubChem CID 127048846) has the molecular formula C30H36N4O6 and a molecular weight of 548.64 g/mol. Its IUPAC name is [(3S,8R,9S,10R,13S,14S)-10,13-dimethyl-17-oxo-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl] 2-[4-[(2-nitrophenoxy)methyl]triazol-1-yl]acetate.
| Compound Name | [(3S,8R,9S,10R,13S,14S)-10,13-dimethyl-17-oxo-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl] 2-[4-[(2-nitrophenoxy)methyl]triazol-1-yl]acetate |
|---|---|
| PubChem CID | 127048846 |
| Molecular Formula | C30H36N4O6 |
| Molecular Weight | 548.64 g/mol |
| Exact Mass | 548.26 |
| IUPAC Name | [(3S,8R,9S,10R,13S,14S)-10,13-dimethyl-17-oxo-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl] 2-[4-[(2-nitrophenoxy)methyl]triazol-1-yl]acetate |
| SMILES | C[C@]12CC[C@H](OC(=O)Cn3cc(COc4ccccc4[N+](=O)[O-])nn3)CC1=CC[C@@H]1[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C30H36N4O6/c1-29-13-11-21(15-19(29)7-8-22-23-9-10-27(35)30(23,2)14-12-24(22)29)40-28(36)17-33-16-20(31-32-33)18-39-26-6-4-3-5-25(26)34(37)38/h3-7,16,21-24H,8-15,17-18H2,1-2H3/t21-,22-,23-,24-,29-,30-/m0/s1 |
| InChIKey | KBMLGPGODLKSJB-CNRUGTJDSA-N |
| XLogP | 5.21 |
| TPSA | 126.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.64 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|