C30H36BrN3O4 — CID 127048847
[(3S,8R,9S,10R,13S,14S)-10,13-dimethyl-17-oxo-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl] 2-[4-[(4-bromophenoxy)methyl]triazol-1-yl]acetate (PubChem CID 127048847) has the molecular formula C30H36BrN3O4 and a molecular weight of 582.54 g/mol. Its IUPAC name is [(3S,8R,9S,10R,13S,14S)-10,13-dimethyl-17-oxo-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl] 2-[4-[(4-bromophenoxy)methyl]triazol-1-yl]acetate.
| Compound Name | [(3S,8R,9S,10R,13S,14S)-10,13-dimethyl-17-oxo-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl] 2-[4-[(4-bromophenoxy)methyl]triazol-1-yl]acetate |
|---|---|
| PubChem CID | 127048847 |
| Molecular Formula | C30H36BrN3O4 |
| Molecular Weight | 582.54 g/mol |
| Exact Mass | 581.19 |
| IUPAC Name | [(3S,8R,9S,10R,13S,14S)-10,13-dimethyl-17-oxo-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl] 2-[4-[(4-bromophenoxy)methyl]triazol-1-yl]acetate |
| SMILES | C[C@]12CC[C@H](OC(=O)Cn3cc(COc4ccc(Br)cc4)nn3)CC1=CC[C@@H]1[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C30H36BrN3O4/c1-29-13-11-23(15-19(29)3-8-24-25-9-10-27(35)30(25,2)14-12-26(24)29)38-28(36)17-34-16-21(32-33-34)18-37-22-6-4-20(31)5-7-22/h3-7,16,23-26H,8-15,17-18H2,1-2H3/t23-,24-,25-,26-,29-,30-/m0/s1 |
| InChIKey | RKICRLQYXPRAQL-SUAVODKESA-N |
| XLogP | 6.06 |
| TPSA | 83.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.54 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|