C31H39N3O4 — CID 127049176
[(3S,8R,9S,10R,13S,14S)-10,13-dimethyl-17-oxo-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl] 2-[4-[(4-methylphenoxy)methyl]triazol-1-yl]acetate (PubChem CID 127049176) has the molecular formula C31H39N3O4 and a molecular weight of 517.67 g/mol. Its IUPAC name is [(3S,8R,9S,10R,13S,14S)-10,13-dimethyl-17-oxo-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl] 2-[4-[(4-methylphenoxy)methyl]triazol-1-yl]acetate.
| Compound Name | [(3S,8R,9S,10R,13S,14S)-10,13-dimethyl-17-oxo-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl] 2-[4-[(4-methylphenoxy)methyl]triazol-1-yl]acetate |
|---|---|
| PubChem CID | 127049176 |
| Molecular Formula | C31H39N3O4 |
| Molecular Weight | 517.67 g/mol |
| Exact Mass | 517.29 |
| IUPAC Name | [(3S,8R,9S,10R,13S,14S)-10,13-dimethyl-17-oxo-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl] 2-[4-[(4-methylphenoxy)methyl]triazol-1-yl]acetate |
| SMILES | Cc1ccc(OCc2cn(CC(=O)O[C@H]3CC[C@@]4(C)C(=CC[C@@H]5[C@@H]4CC[C@]4(C)C(=O)CC[C@@H]54)C3)nn2)cc1 |
| InChI | InChI=1S/C31H39N3O4/c1-20-4-7-23(8-5-20)37-19-22-17-34(33-32-22)18-29(36)38-24-12-14-30(2)21(16-24)6-9-25-26-10-11-28(35)31(26,3)15-13-27(25)30/h4-8,17,24-27H,9-16,18-19H2,1-3H3/t24-,25-,26-,27-,30-,31-/m0/s1 |
| InChIKey | YLGXDGNAZDDRHG-AXOMYGEFSA-N |
| XLogP | 5.61 |
| TPSA | 83.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.67 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|