About methyl 3-chloro-4,6-dihydroxy-2-[2-[1-(thiophen-3-ylmethyl)imidazol-2-yl]ethyl]benzoate
methyl 3-chloro-4,6-dihydroxy-2-[2-[1-(thiophen-3-ylmethyl)imidazol-2-yl]ethyl]benzoate (PubChem CID 127049183) has the molecular formula C18H17ClN2O4S
and a molecular weight of 392.86 g/mol. Its IUPAC name is methyl 3-chloro-4,6-dihydroxy-2-[2-[1-(thiophen-3-ylmethyl)imidazol-2-yl]ethyl]benzoate.
Molecular Properties
| Compound Name | methyl 3-chloro-4,6-dihydroxy-2-[2-[1-(thiophen-3-ylmethyl)imidazol-2-yl]ethyl]benzoate |
| PubChem CID | 127049183 |
| Molecular Formula | C18H17ClN2O4S |
| Molecular Weight | 392.86 g/mol |
| Exact Mass | 392.06 |
| IUPAC Name | methyl 3-chloro-4,6-dihydroxy-2-[2-[1-(thiophen-3-ylmethyl)imidazol-2-yl]ethyl]benzoate |
| SMILES | COC(=O)c1c(O)cc(O)c(Cl)c1CCc1nccn1Cc1ccsc1 |
| InChI | InChI=1S/C18H17ClN2O4S/c1-25-18(24)16-12(17(19)14(23)8-13(16)22)2-3-15-20-5-6-21(15)9-11-4-7-26-10-11/h4-8,10,22-23H,2-3,9H2,1H3 |
| InChIKey | AOCUFIAKBVXZPG-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.86 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl 3-chloro-4,6-dihydroxy-2-[2-[1-(thiophen-3-ylmethyl)imidazol-2-yl]ethyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-chloro-4,6-dihydroxy-2-[2-[1-(thiophen-3-ylmethyl)imidazol-2-yl]ethyl]benzoate?
The IUPAC name of methyl 3-chloro-4,6-dihydroxy-2-[2-[1-(thiophen-3-ylmethyl)imidazol-2-yl]ethyl]benzoate (CID 127049183) is methyl 3-chloro-4,6-dihydroxy-2-[2-[1-(thiophen-3-ylmethyl)imidazol-2-yl]ethyl]benzoate.
What is the SMILES notation for methyl 3-chloro-4,6-dihydroxy-2-[2-[1-(thiophen-3-ylmethyl)imidazol-2-yl]ethyl]benzoate?
The canonical SMILES for methyl 3-chloro-4,6-dihydroxy-2-[2-[1-(thiophen-3-ylmethyl)imidazol-2-yl]ethyl]benzoate is COC(=O)c1c(O)cc(O)c(Cl)c1CCc1nccn1Cc1ccsc1.
What is the InChIKey of methyl 3-chloro-4,6-dihydroxy-2-[2-[1-(thiophen-3-ylmethyl)imidazol-2-yl]ethyl]benzoate?
The InChIKey is AOCUFIAKBVXZPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17ClN2O4S/c1-25-18(24)16-12(17(19)14(23)8-13(16)22)2-3-15-20-5-6-21(15)9-11-4-7-26-10-11/h4-8,10,22-23H,2-3,9H2,1H3.
What are the key properties of methyl 3-chloro-4,6-dihydroxy-2-[2-[1-(thiophen-3-ylmethyl)imidazol-2-yl]ethyl]benzoate?
methyl 3-chloro-4,6-dihydroxy-2-[2-[1-(thiophen-3-ylmethyl)imidazol-2-yl]ethyl]benzoate has a molecular weight of 392.86 g/mol, XLogP of 3.63, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-chloro-4,6-dihydroxy-2-[2-[1-(thiophen-3-ylmethyl)imidazol-2-yl]ethyl]benzoate is sourced from PubChem (CID 127049183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).