C22H22F5N5O3 — CID 127049203
(2R,3S,5R)-2-(2,5-difluorophenyl)-5-(11-methyl-4,7,8,12-tetrazatricyclo[6.4.0.02,6]dodeca-1,6,9,11-tetraen-4-yl)oxan-3-amine;2,2,2-trifluoroacetic acid (PubChem CID 127049203) has the molecular formula C22H22F5N5O3 and a molecular weight of 499.44 g/mol. Its IUPAC name is (2R,3S,5R)-2-(2,5-difluorophenyl)-5-(11-methyl-4,7,8,12-tetrazatricyclo[6.4.0.02,6]dodeca-1,6,9,11-tetraen-4-yl)oxan-3-amine;2,2,2-trifluoroacetic acid.
| Compound Name | (2R,3S,5R)-2-(2,5-difluorophenyl)-5-(11-methyl-4,7,8,12-tetrazatricyclo[6.4.0.02,6]dodeca-1,6,9,11-tetraen-4-yl)oxan-3-amine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 127049203 |
| Molecular Formula | C22H22F5N5O3 |
| Molecular Weight | 499.44 g/mol |
| Exact Mass | 499.16 |
| IUPAC Name | (2R,3S,5R)-2-(2,5-difluorophenyl)-5-(11-methyl-4,7,8,12-tetrazatricyclo[6.4.0.02,6]dodeca-1,6,9,11-tetraen-4-yl)oxan-3-amine;2,2,2-trifluoroacetic acid |
| SMILES | Cc1ccn2nc3c(c2n1)CN([C@H]1CO[C@H](c2cc(F)ccc2F)[C@@H](N)C1)C3.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C20H21F2N5O.C2HF3O2/c1-11-4-5-27-20(24-11)15-8-26(9-18(15)25-27)13-7-17(23)19(28-10-13)14-6-12(21)2-3-16(14)22;3-2(4,5)1(6)7/h2-6,13,17,19H,7-10,23H2,1H3;(H,6,7)/t13-,17+,19-;/m1./s1 |
| InChIKey | WWLVKGNPVIFNBR-GBFYRWPISA-N |
| XLogP | 3.12 |
| TPSA | 105.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.44 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |