C20H21FN4OS — CID 127049214
N-[4-(4-fluorophenyl)piperidin-4-yl]-4-(2-methylpyrazol-3-yl)thiophene-2-carboxamide (PubChem CID 127049214) has the molecular formula C20H21FN4OS and a molecular weight of 384.48 g/mol. Its IUPAC name is N-[4-(4-fluorophenyl)piperidin-4-yl]-4-(2-methylpyrazol-3-yl)thiophene-2-carboxamide.
| Compound Name | N-[4-(4-fluorophenyl)piperidin-4-yl]-4-(2-methylpyrazol-3-yl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 127049214 |
| Molecular Formula | C20H21FN4OS |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | N-[4-(4-fluorophenyl)piperidin-4-yl]-4-(2-methylpyrazol-3-yl)thiophene-2-carboxamide |
| SMILES | Cn1nccc1-c1csc(C(=O)NC2(c3ccc(F)cc3)CCNCC2)c1 |
| InChI | InChI=1S/C20H21FN4OS/c1-25-17(6-9-23-25)14-12-18(27-13-14)19(26)24-20(7-10-22-11-8-20)15-2-4-16(21)5-3-15/h2-6,9,12-13,22H,7-8,10-11H2,1H3,(H,24,26) |
| InChIKey | NAIQKXKDKHEYMA-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |