About 3-iodo-2,4-dimethylpent-2-ene
3-iodo-2,4-dimethylpent-2-ene (PubChem CID 12704924) has the molecular formula C7H13I
and a molecular weight of 224.08 g/mol. Its IUPAC name is 3-iodo-2,4-dimethylpent-2-ene.
Molecular Properties
| Compound Name | 3-iodo-2,4-dimethylpent-2-ene |
| PubChem CID | 12704924 |
| Molecular Formula | C7H13I |
| Molecular Weight | 224.08 g/mol |
| Exact Mass | 224.01 |
| IUPAC Name | 3-iodo-2,4-dimethylpent-2-ene |
| SMILES | CC(C)=C(I)C(C)C |
| InChI | InChI=1S/C7H13I/c1-5(2)7(8)6(3)4/h5H,1-4H3 |
| InChIKey | ZWIMOOJIBJHAQN-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.08 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-iodo-2,4-dimethylpent-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-iodo-2,4-dimethylpent-2-ene?
The IUPAC name of 3-iodo-2,4-dimethylpent-2-ene (CID 12704924) is 3-iodo-2,4-dimethylpent-2-ene.
What is the SMILES notation for 3-iodo-2,4-dimethylpent-2-ene?
The canonical SMILES for 3-iodo-2,4-dimethylpent-2-ene is CC(C)=C(I)C(C)C.
What is the InChIKey of 3-iodo-2,4-dimethylpent-2-ene?
The InChIKey is ZWIMOOJIBJHAQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13I/c1-5(2)7(8)6(3)4/h5H,1-4H3.
What are the key properties of 3-iodo-2,4-dimethylpent-2-ene?
3-iodo-2,4-dimethylpent-2-ene has a molecular weight of 224.08 g/mol, XLogP of 3.37, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-iodo-2,4-dimethylpent-2-ene is sourced from PubChem (CID 12704924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).