About N-(2,4-dimethylpentan-3-ylideneamino)-2,4-dimethylpentan-3-imine
N-(2,4-dimethylpentan-3-ylideneamino)-2,4-dimethylpentan-3-imine (PubChem CID 12704925) has the molecular formula C14H28N2
and a molecular weight of 224.39 g/mol. Its IUPAC name is N-(2,4-dimethylpentan-3-ylideneamino)-2,4-dimethylpentan-3-imine.
Molecular Properties
| Compound Name | N-(2,4-dimethylpentan-3-ylideneamino)-2,4-dimethylpentan-3-imine |
| PubChem CID | 12704925 |
| Molecular Formula | C14H28N2 |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.23 |
| IUPAC Name | N-(2,4-dimethylpentan-3-ylideneamino)-2,4-dimethylpentan-3-imine |
| SMILES | CC(C)C(=NN=C(C(C)C)C(C)C)C(C)C |
| InChI | InChI=1S/C14H28N2/c1-9(2)13(10(3)4)15-16-14(11(5)6)12(7)8/h9-12H,1-8H3 |
| InChIKey | LTHOJRVNLMLEFL-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(2,4-dimethylpentan-3-ylideneamino)-2,4-dimethylpentan-3-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,4-dimethylpentan-3-ylideneamino)-2,4-dimethylpentan-3-imine?
The IUPAC name of N-(2,4-dimethylpentan-3-ylideneamino)-2,4-dimethylpentan-3-imine (CID 12704925) is N-(2,4-dimethylpentan-3-ylideneamino)-2,4-dimethylpentan-3-imine.
What is the SMILES notation for N-(2,4-dimethylpentan-3-ylideneamino)-2,4-dimethylpentan-3-imine?
The canonical SMILES for N-(2,4-dimethylpentan-3-ylideneamino)-2,4-dimethylpentan-3-imine is CC(C)C(=NN=C(C(C)C)C(C)C)C(C)C.
What is the InChIKey of N-(2,4-dimethylpentan-3-ylideneamino)-2,4-dimethylpentan-3-imine?
The InChIKey is LTHOJRVNLMLEFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28N2/c1-9(2)13(10(3)4)15-16-14(11(5)6)12(7)8/h9-12H,1-8H3.
What are the key properties of N-(2,4-dimethylpentan-3-ylideneamino)-2,4-dimethylpentan-3-imine?
N-(2,4-dimethylpentan-3-ylideneamino)-2,4-dimethylpentan-3-imine has a molecular weight of 224.39 g/mol, XLogP of 4.41, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,4-dimethylpentan-3-ylideneamino)-2,4-dimethylpentan-3-imine is sourced from PubChem (CID 12704925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).