C22H18N2O2 — CID 127049309
3,4-diphenyl-2,3,3a,4-tetrahydrochromeno[4,3-c]pyrazol-8-ol (PubChem CID 127049309) has the molecular formula C22H18N2O2 and a molecular weight of 342.40 g/mol. Its IUPAC name is 3,4-diphenyl-2,3,3a,4-tetrahydrochromeno[4,3-c]pyrazol-8-ol.
| Compound Name | 3,4-diphenyl-2,3,3a,4-tetrahydrochromeno[4,3-c]pyrazol-8-ol |
|---|---|
| PubChem CID | 127049309 |
| Molecular Formula | C22H18N2O2 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | 3,4-diphenyl-2,3,3a,4-tetrahydrochromeno[4,3-c]pyrazol-8-ol |
| SMILES | Oc1ccc2c(c1)C1=NNC(c3ccccc3)C1C(c1ccccc1)O2 |
| InChI | InChI=1S/C22H18N2O2/c25-16-11-12-18-17(13-16)21-19(22(26-18)15-9-5-2-6-10-15)20(23-24-21)14-7-3-1-4-8-14/h1-13,19-20,22-23,25H |
| InChIKey | ZHOSBMNCIFOAEH-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |